C12H14BrNO4S — CID 47305556
methyl 1-(3-bromophenyl)sulfonylpyrrolidine-3-carboxylate (PubChem CID 47305556) has the molecular formula C12H14BrNO4S and a molecular weight of 348.22 g/mol. Its IUPAC name is methyl 1-(3-bromophenyl)sulfonylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-bromophenyl)sulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 47305556 |
| Molecular Formula | C12H14BrNO4S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | methyl 1-(3-bromophenyl)sulfonylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C12H14BrNO4S/c1-18-12(15)9-5-6-14(8-9)19(16,17)11-4-2-3-10(13)7-11/h2-4,7,9H,5-6,8H2,1H3 |
| InChIKey | UMURRCWVEMTEBL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |