C12H14BrNO5S — CID 78927097
methyl 4-(3-bromophenyl)sulfonylmorpholine-2-carboxylate (PubChem CID 78927097) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is methyl 4-(3-bromophenyl)sulfonylmorpholine-2-carboxylate.
| Compound Name | methyl 4-(3-bromophenyl)sulfonylmorpholine-2-carboxylate |
|---|---|
| PubChem CID | 78927097 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | methyl 4-(3-bromophenyl)sulfonylmorpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(S(=O)(=O)c2cccc(Br)c2)CCO1 |
| InChI | InChI=1S/C12H14BrNO5S/c1-18-12(15)11-8-14(5-6-19-11)20(16,17)10-4-2-3-9(13)7-10/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | KXCXPCAAFBLPKX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |