C12H13Cl2NO4S — CID 112732213
methyl 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-3-carboxylate (PubChem CID 112732213) has the molecular formula C12H13Cl2NO4S and a molecular weight of 338.21 g/mol. Its IUPAC name is methyl 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 112732213 |
| Molecular Formula | C12H13Cl2NO4S |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | methyl 1-(3,4-dichlorophenyl)sulfonylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H13Cl2NO4S/c1-19-12(16)8-4-5-15(7-8)20(17,18)9-2-3-10(13)11(14)6-9/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | LPWKVMRLDOAADC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |