C17H23BrN2O3S — CID 175666701
1-(3-bromophenyl)sulfonyl-N-cyclohexylpyrrolidine-3-carboxamide (PubChem CID 175666701) has the molecular formula C17H23BrN2O3S and a molecular weight of 415.35 g/mol. Its IUPAC name is 1-(3-bromophenyl)sulfonyl-N-cyclohexylpyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)sulfonyl-N-cyclohexylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 175666701 |
| Molecular Formula | C17H23BrN2O3S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-(3-bromophenyl)sulfonyl-N-cyclohexylpyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCN(S(=O)(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C17H23BrN2O3S/c18-14-5-4-8-16(11-14)24(22,23)20-10-9-13(12-20)17(21)19-15-6-2-1-3-7-15/h4-5,8,11,13,15H,1-3,6-7,9-10,12H2,(H,19,21) |
| InChIKey | ALZZSFCXYPNUIK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |