About lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride
lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride (PubChem CID 175429847) has the molecular formula C11H13FLiNO4S
and a molecular weight of 281.23 g/mol. Its IUPAC name is lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride.
Molecular Properties
| Compound Name | lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride |
| PubChem CID | 175429847 |
| Molecular Formula | C11H13FLiNO4S |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride |
| SMILES | Cc1cccc(S(=O)(=O)N2CC(C(=O)OF)C2)c1.[H-].[Li+] |
| InChI | InChI=1S/C11H12FNO4S.Li.H/c1-8-3-2-4-10(5-8)18(15,16)13-6-9(7-13)11(14)17-12;;/h2-5,9H,6-7H2,1H3;;/q;+1;-1 |
| InChIKey | SFHBLZORQGKHBH-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride?
The IUPAC name of lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride (CID 175429847) is lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride.
What is the SMILES notation for lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride?
The canonical SMILES for lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride is Cc1cccc(S(=O)(=O)N2CC(C(=O)OF)C2)c1.[H-].[Li+].
What is the InChIKey of lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride?
The InChIKey is SFHBLZORQGKHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNO4S.Li.H/c1-8-3-2-4-10(5-8)18(15,16)13-6-9(7-13)11(14)17-12;;/h2-5,9H,6-7H2,1H3;;/q;+1;-1.
What are the key properties of lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride?
lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride has a molecular weight of 281.23 g/mol, XLogP of -1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;fluoro 1-(3-methylphenyl)sulfonylazetidine-3-carboxylate;hydride is sourced from PubChem (CID 175429847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).