C12H17NO5S — CID 79031397
(3S)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidin-3-ol (PubChem CID 79031397) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is (3S)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3S)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 79031397 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (3S)-1-(3,4-dimethoxyphenyl)sulfonylpyrrolidin-3-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@H](O)C2)cc1OC |
| InChI | InChI=1S/C12H17NO5S/c1-17-11-4-3-10(7-12(11)18-2)19(15,16)13-6-5-9(14)8-13/h3-4,7,9,14H,5-6,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | SWCRDRCVNOZZIS-VIFPVBQESA-N |
| XLogP | 0.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |