C14H21NO6S2 — CID 90585253
1-(3,4-dimethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine (PubChem CID 90585253) has the molecular formula C14H21NO6S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 90585253 |
| Molecular Formula | C14H21NO6S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(S(C)(=O)=O)CC2)cc1OC |
| InChI | InChI=1S/C14H21NO6S2/c1-20-13-5-4-12(10-14(13)21-2)23(18,19)15-8-6-11(7-9-15)22(3,16)17/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | QNPQCDCGAJTTMP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |