C19H30N2O4S — CID 17468522
1-(cyclohexylmethyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 17468522) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 1-(cyclohexylmethyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 17468522 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-(3,4-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CC3CCCCC3)CC2)cc1OC |
| InChI | InChI=1S/C19H30N2O4S/c1-24-18-9-8-17(14-19(18)25-2)26(22,23)21-12-10-20(11-13-21)15-16-6-4-3-5-7-16/h8-9,14,16H,3-7,10-13,15H2,1-2H3 |
| InChIKey | KZOPDJMHDSKOLP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |