C13H21N2O4S+ — CID 6952496
1-(3,4-dimethoxyphenyl)sulfonyl-4-methylpiperazin-4-ium (PubChem CID 6952496) has the molecular formula C13H21N2O4S+ and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylpiperazin-4-ium.
| Compound Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylpiperazin-4-ium |
|---|---|
| PubChem CID | 6952496 |
| Molecular Formula | C13H21N2O4S+ |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)sulfonyl-4-methylpiperazin-4-ium |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](C)CC2)cc1OC |
| InChI | InChI=1S/C13H20N2O4S/c1-14-6-8-15(9-7-14)20(16,17)11-4-5-12(18-2)13(10-11)19-3/h4-5,10H,6-9H2,1-3H3/p+1 |
| InChIKey | QJOSJAJYIAVDBH-UHFFFAOYSA-O |
| XLogP | -0.78 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |