C19H30N3O4S+ — CID 7964116
[5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-(4-methylpiperazin-4-ium-1-yl)methanone (PubChem CID 7964116) has the molecular formula C19H30N3O4S+ and a molecular weight of 396.53 g/mol. Its IUPAC name is [5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-(4-methylpiperazin-4-ium-1-yl)methanone.
| Compound Name | [5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-(4-methylpiperazin-4-ium-1-yl)methanone |
|---|---|
| PubChem CID | 7964116 |
| Molecular Formula | C19H30N3O4S+ |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [5-(azepan-1-ylsulfonyl)-2-methoxyphenyl]-(4-methylpiperazin-4-ium-1-yl)methanone |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C19H29N3O4S/c1-20-11-13-21(14-12-20)19(23)17-15-16(7-8-18(17)26-2)27(24,25)22-9-5-3-4-6-10-22/h7-8,15H,3-6,9-14H2,1-2H3/p+1 |
| InChIKey | VJERNTWAHNNMQD-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |