C13H16ClNO4S — CID 20982776
2-methoxy-5-piperidin-1-ylsulfonylbenzoyl chloride (PubChem CID 20982776) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 2-methoxy-5-piperidin-1-ylsulfonylbenzoyl chloride.
| Compound Name | 2-methoxy-5-piperidin-1-ylsulfonylbenzoyl chloride |
|---|---|
| PubChem CID | 20982776 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-methoxy-5-piperidin-1-ylsulfonylbenzoyl chloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)Cl |
| InChI | InChI=1S/C13H16ClNO4S/c1-19-12-6-5-10(9-11(12)13(14)16)20(17,18)15-7-3-2-4-8-15/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | BKAUVBSBKYURKN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|