C17H23NO7S — CID 16568706
(2-methoxy-2-oxoethyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 16568706) has the molecular formula C17H23NO7S and a molecular weight of 385.44 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 16568706 |
| Molecular Formula | C17H23NO7S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | COC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCCCC2)ccc1OC |
| InChI | InChI=1S/C17H23NO7S/c1-23-15-8-7-13(11-14(15)17(20)25-12-16(19)24-2)26(21,22)18-9-5-3-4-6-10-18/h7-8,11H,3-6,9-10,12H2,1-2H3 |
| InChIKey | WZXUARAVIFSDJT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |