C22H32N2O6S — CID 23961089
[2-(3-methylpiperidin-1-yl)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 23961089) has the molecular formula C22H32N2O6S and a molecular weight of 452.57 g/mol. Its IUPAC name is [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 23961089 |
| Molecular Formula | C22H32N2O6S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | [2-(3-methylpiperidin-1-yl)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)OCC(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C22H32N2O6S/c1-17-8-7-11-23(15-17)21(25)16-30-22(26)19-14-18(9-10-20(19)29-2)31(27,28)24-12-5-3-4-6-13-24/h9-10,14,17H,3-8,11-13,15-16H2,1-2H3 |
| InChIKey | XKUGSZAEQGPLDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |