C20H25N3O6S — CID 3250459
(4-amino-3-cyano-2-oxopent-3-enyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 3250459) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is (4-amino-3-cyano-2-oxopent-3-enyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | (4-amino-3-cyano-2-oxopent-3-enyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 3250459 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (4-amino-3-cyano-2-oxopent-3-enyl) 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)N2CCCCCC2)cc1C(=O)OCC(=O)C(C#N)=C(C)N |
| InChI | InChI=1S/C20H25N3O6S/c1-14(22)17(12-21)18(24)13-29-20(25)16-11-15(7-8-19(16)28-2)30(26,27)23-9-5-3-4-6-10-23/h7-8,11H,3-6,9-10,13,22H2,1-2H3 |
| InChIKey | HFVPHSNTIONLTI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|