C20H29N3O8S — CID 16534464
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 16534464) has the molecular formula C20H29N3O8S and a molecular weight of 471.53 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 16534464 |
| Molecular Formula | C20H29N3O8S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 5-(azepan-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCCCC2)ccc1OC |
| InChI | InChI=1S/C20H29N3O8S/c1-29-12-9-21-20(26)22-18(24)14-31-19(25)16-13-15(7-8-17(16)30-2)32(27,28)23-10-5-3-4-6-11-23/h7-8,13H,3-6,9-12,14H2,1-2H3,(H2,21,22,24,26) |
| InChIKey | IWHHPANZFSLZGA-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|