C18H29N3O4S — CID 119430959
5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(methylamino)propyl]benzamide (PubChem CID 119430959) has the molecular formula C18H29N3O4S and a molecular weight of 383.51 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(methylamino)propyl]benzamide.
| Compound Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 119430959 |
| Molecular Formula | C18H29N3O4S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-2-methoxy-N-[3-(methylamino)propyl]benzamide |
| SMILES | CNCCCNC(=O)c1cc(S(=O)(=O)N2CCCCCC2)ccc1OC |
| InChI | InChI=1S/C18H29N3O4S/c1-19-10-7-11-20-18(22)16-14-15(8-9-17(16)25-2)26(23,24)21-12-5-3-4-6-13-21/h8-9,14,19H,3-7,10-13H2,1-2H3,(H,20,22) |
| InChIKey | LKGSKCXNXCAFGH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|