C24H31N3O6S2 — CID 28590945
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-methoxy-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 28590945) has the molecular formula C24H31N3O6S2 and a molecular weight of 521.66 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-methoxy-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-methoxy-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 28590945 |
| Molecular Formula | C24H31N3O6S2 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-methoxy-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC2)cc1C(=O)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O6S2/c1-33-23-13-12-21(35(31,32)27-16-6-7-17-27)18-22(23)24(28)25-19-8-10-20(11-9-19)34(29,30)26-14-4-2-3-5-15-26/h8-13,18H,2-7,14-17H2,1H3,(H,25,28) |
| InChIKey | OZIKJFXKVYNVRR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |