C25H27N3O7S2 — CID 43882655
2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 43882655) has the molecular formula C25H27N3O7S2 and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43882655 |
| Molecular Formula | C25H27N3O7S2 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cc(S(=O)(=O)N4CCCC4)ccc3OC)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O7S2/c1-34-20-9-5-19(6-10-20)27-36(30,31)21-11-7-18(8-12-21)26-25(29)23-17-22(13-14-24(23)35-2)37(32,33)28-15-3-4-16-28/h5-14,17,27H,3-4,15-16H2,1-2H3,(H,26,29) |
| InChIKey | NMULGTCFSNQEHX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |