C21H19BrN2O5S — CID 17094200
5-bromo-2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 17094200) has the molecular formula C21H19BrN2O5S and a molecular weight of 491.36 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17094200 |
| Molecular Formula | C21H19BrN2O5S |
| Molecular Weight | 491.36 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | 5-bromo-2-methoxy-N-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cc(Br)ccc3OC)cc2)cc1 |
| InChI | InChI=1S/C21H19BrN2O5S/c1-28-17-8-4-16(5-9-17)24-30(26,27)18-10-6-15(7-11-18)23-21(25)19-13-14(22)3-12-20(19)29-2/h3-13,24H,1-2H3,(H,23,25) |
| InChIKey | FYRGLLXWYUBBAM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |