C23H23BrN2O5S — CID 17352919
5-bromo-2-ethoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide (PubChem CID 17352919) has the molecular formula C23H23BrN2O5S and a molecular weight of 519.42 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 17352919 |
| Molecular Formula | C23H23BrN2O5S |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[4-[(4-ethoxyphenyl)sulfamoyl]phenyl]benzamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(NC(=O)c3cc(Br)ccc3OCC)cc2)cc1 |
| InChI | InChI=1S/C23H23BrN2O5S/c1-3-30-19-10-6-18(7-11-19)26-32(28,29)20-12-8-17(9-13-20)25-23(27)21-15-16(24)5-14-22(21)31-4-2/h5-15,26H,3-4H2,1-2H3,(H,25,27) |
| InChIKey | LJLKUBUYOCYFKR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |