C24H24BrN3O6S2 — CID 17357443
5-bromo-2-(2-methoxyethoxy)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17357443) has the molecular formula C24H24BrN3O6S2 and a molecular weight of 594.51 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17357443 |
| Molecular Formula | C24H24BrN3O6S2 |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 593.03 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24BrN3O6S2/c1-32-13-14-34-22-12-3-16(25)15-21(22)23(29)27-24(35)26-17-6-10-20(11-7-17)36(30,31)28-18-4-8-19(33-2)9-5-18/h3-12,15,28H,13-14H2,1-2H3,(H2,26,27,29,35) |
| InChIKey | MTWAQQZWHREGOB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|