C20H22BrN3O5S2 — CID 17350436
N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-5-bromo-2-butoxybenzamide (PubChem CID 17350436) has the molecular formula C20H22BrN3O5S2 and a molecular weight of 528.45 g/mol. Its IUPAC name is N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-5-bromo-2-butoxybenzamide.
| Compound Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-5-bromo-2-butoxybenzamide |
|---|---|
| PubChem CID | 17350436 |
| Molecular Formula | C20H22BrN3O5S2 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 527.02 |
| IUPAC Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-5-bromo-2-butoxybenzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C20H22BrN3O5S2/c1-3-4-11-29-18-10-5-14(21)12-17(18)19(26)23-20(30)22-15-6-8-16(9-7-15)31(27,28)24-13(2)25/h5-10,12H,3-4,11H2,1-2H3,(H,24,25)(H2,22,23,26,30) |
| InChIKey | FUISDRZOHPIXHC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|