C25H26BrN3O5S2 — CID 17357546
5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357546) has the molecular formula C25H26BrN3O5S2 and a molecular weight of 592.54 g/mol. Its IUPAC name is 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357546 |
| Molecular Formula | C25H26BrN3O5S2 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C25H26BrN3O5S2/c1-16-12-17(2)14-20(13-16)29-36(31,32)21-7-5-19(6-8-21)27-25(35)28-24(30)22-15-18(26)4-9-23(22)34-11-10-33-3/h4-9,12-15,29H,10-11H2,1-3H3,(H2,27,28,30,35) |
| InChIKey | ACBWUIBYFPNENW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|