C25H26BrN3O4S2 — CID 17350957
5-bromo-2-(3-methylbutoxy)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17350957) has the molecular formula C25H26BrN3O4S2 and a molecular weight of 576.54 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350957 |
| Molecular Formula | C25H26BrN3O4S2 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26BrN3O4S2/c1-17(2)14-15-33-23-13-8-18(26)16-22(23)24(30)28-25(34)27-19-9-11-21(12-10-19)35(31,32)29-20-6-4-3-5-7-20/h3-13,16-17,29H,14-15H2,1-2H3,(H2,27,28,30,34) |
| InChIKey | IZQXKDOATTWSAJ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|