C30H28BrN3O4S2 — CID 17046578
5-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide (PubChem CID 17046578) has the molecular formula C30H28BrN3O4S2 and a molecular weight of 638.61 g/mol. Its IUPAC name is 5-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide.
| Compound Name | 5-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17046578 |
| Molecular Formula | C30H28BrN3O4S2 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | 5-bromo-N-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenylethoxy)benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3OCCc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C30H28BrN3O4S2/c1-20-8-10-25(18-21(20)2)34-40(36,37)26-13-11-24(12-14-26)32-30(39)33-29(35)27-19-23(31)9-15-28(27)38-17-16-22-6-4-3-5-7-22/h3-15,18-19,34H,16-17H2,1-2H3,(H2,32,33,35,39) |
| InChIKey | HATKXNQFXFZJSB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|