C24H24BrN3O4S2 — CID 17353135
5-bromo-2-ethoxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17353135) has the molecular formula C24H24BrN3O4S2 and a molecular weight of 562.51 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17353135 |
| Molecular Formula | C24H24BrN3O4S2 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[[4-(2-phenylethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24BrN3O4S2/c1-2-32-22-13-8-18(25)16-21(22)23(29)28-24(33)27-19-9-11-20(12-10-19)34(30,31)26-15-14-17-6-4-3-5-7-17/h3-13,16,26H,2,14-15H2,1H3,(H2,27,28,29,33) |
| InChIKey | GGYAUNMTSZYOQM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|