C27H31BrN2O4S — CID 17343328
5-bromo-2-hexoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 17343328) has the molecular formula C27H31BrN2O4S and a molecular weight of 559.53 g/mol. Its IUPAC name is 5-bromo-2-hexoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-hexoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17343328 |
| Molecular Formula | C27H31BrN2O4S |
| Molecular Weight | 559.53 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | 5-bromo-2-hexoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H31BrN2O4S/c1-2-3-4-8-19-34-26-16-11-22(28)20-25(26)27(31)30-23-12-14-24(15-13-23)35(32,33)29-18-17-21-9-6-5-7-10-21/h5-7,9-16,20,29H,2-4,8,17-19H2,1H3,(H,30,31) |
| InChIKey | WBZGLIQTAJLDPD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|