C25H27BrN2O4S — CID 17349933
5-bromo-2-butoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 17349933) has the molecular formula C25H27BrN2O4S and a molecular weight of 531.47 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17349933 |
| Molecular Formula | C25H27BrN2O4S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 5-bromo-2-butoxy-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H27BrN2O4S/c1-2-3-17-32-24-14-9-20(26)18-23(24)25(29)28-21-10-12-22(13-11-21)33(30,31)27-16-15-19-7-5-4-6-8-19/h4-14,18,27H,2-3,15-17H2,1H3,(H,28,29) |
| InChIKey | ZZPDUMIJXWGGRO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|