C24H23BrN2O4S — CID 17046182
5-bromo-2-(2-phenylethoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]benzamide (PubChem CID 17046182) has the molecular formula C24H23BrN2O4S and a molecular weight of 515.43 g/mol. Its IUPAC name is 5-bromo-2-(2-phenylethoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-(2-phenylethoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17046182 |
| Molecular Formula | C24H23BrN2O4S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 5-bromo-2-(2-phenylethoxy)-N-[4-(prop-2-enylsulfamoyl)phenyl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=O)c2cc(Br)ccc2OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23BrN2O4S/c1-2-15-26-32(29,30)21-11-9-20(10-12-21)27-24(28)22-17-19(25)8-13-23(22)31-16-14-18-6-4-3-5-7-18/h2-13,17,26H,1,14-16H2,(H,27,28) |
| InChIKey | LDOQOPDPQPNHFC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|