C22H20BrN3O4S2 — CID 17046599
5-bromo-2-(2-phenylethoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide (PubChem CID 17046599) has the molecular formula C22H20BrN3O4S2 and a molecular weight of 534.46 g/mol. Its IUPAC name is 5-bromo-2-(2-phenylethoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(2-phenylethoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17046599 |
| Molecular Formula | C22H20BrN3O4S2 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.01 |
| IUPAC Name | 5-bromo-2-(2-phenylethoxy)-N-[(4-sulfamoylphenyl)carbamothioyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20BrN3O4S2/c23-16-6-11-20(30-13-12-15-4-2-1-3-5-15)19(14-16)21(27)26-22(31)25-17-7-9-18(10-8-17)32(24,28)29/h1-11,14H,12-13H2,(H2,24,28,29)(H2,25,26,27,31) |
| InChIKey | GSLYBZDYLQSQIJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|