C28H28BrN3O4S2 — CID 17046688
N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-(2-phenylethoxy)benzamide (PubChem CID 17046688) has the molecular formula C28H28BrN3O4S2 and a molecular weight of 614.59 g/mol. Its IUPAC name is N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-(2-phenylethoxy)benzamide.
| Compound Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17046688 |
| Molecular Formula | C28H28BrN3O4S2 |
| Molecular Weight | 614.59 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-(2-phenylethoxy)benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28BrN3O4S2/c1-3-17-32(18-4-2)38(34,35)24-13-11-23(12-14-24)30-28(37)31-27(33)25-20-22(29)10-15-26(25)36-19-16-21-8-6-5-7-9-21/h3-15,20H,1-2,16-19H2,(H2,30,31,33,37) |
| InChIKey | PBEROSJYAMHWSJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|