C23H26BrN3O4S2 — CID 17352062
N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide (PubChem CID 17352062) has the molecular formula C23H26BrN3O4S2 and a molecular weight of 552.52 g/mol. Its IUPAC name is N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide.
| Compound Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide |
|---|---|
| PubChem CID | 17352062 |
| Molecular Formula | C23H26BrN3O4S2 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | N-[[4-[bis(prop-2-enyl)sulfamoyl]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCC)cc1 |
| InChI | InChI=1S/C23H26BrN3O4S2/c1-4-13-27(14-5-2)33(29,30)19-10-8-18(9-11-19)25-23(32)26-22(28)20-16-17(24)7-12-21(20)31-15-6-3/h4-5,7-12,16H,1-2,6,13-15H2,3H3,(H2,25,26,28,32) |
| InChIKey | MKMMBEHHSJABFQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|