C23H27BrN2O4S — CID 17350017
N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-5-bromo-2-butoxybenzamide (PubChem CID 17350017) has the molecular formula C23H27BrN2O4S and a molecular weight of 507.45 g/mol. Its IUPAC name is N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-5-bromo-2-butoxybenzamide.
| Compound Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-5-bromo-2-butoxybenzamide |
|---|---|
| PubChem CID | 17350017 |
| Molecular Formula | C23H27BrN2O4S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-5-bromo-2-butoxybenzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)c2cc(Br)ccc2OCCCC)cc1 |
| InChI | InChI=1S/C23H27BrN2O4S/c1-4-7-16-30-22-13-8-18(24)17-21(22)23(27)25-19-9-11-20(12-10-19)31(28,29)26(14-5-2)15-6-3/h5-6,8-13,17H,2-4,7,14-16H2,1H3,(H,25,27) |
| InChIKey | FWHTVRWHTIPRPQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|