C25H32N2O4S — CID 4933660
N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-hexoxybenzamide (PubChem CID 4933660) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-hexoxybenzamide.
| Compound Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4933660 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | N-[4-[bis(prop-2-enyl)sulfamoyl]phenyl]-4-hexoxybenzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(NC(=O)c2ccc(OCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O4S/c1-4-7-8-9-20-31-23-14-10-21(11-15-23)25(28)26-22-12-16-24(17-13-22)32(29,30)27(18-5-2)19-6-3/h5-6,10-17H,2-4,7-9,18-20H2,1H3,(H,26,28) |
| InChIKey | JGMBVTFKSANCSV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|