C22H30N2O4S — CID 4935093
N-[4-(tert-butylsulfamoyl)phenyl]-4-pentoxybenzamide (PubChem CID 4935093) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-[4-(tert-butylsulfamoyl)phenyl]-4-pentoxybenzamide.
| Compound Name | N-[4-(tert-butylsulfamoyl)phenyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 4935093 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[4-(tert-butylsulfamoyl)phenyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H30N2O4S/c1-5-6-7-16-28-19-12-8-17(9-13-19)21(25)23-18-10-14-20(15-11-18)29(26,27)24-22(2,3)4/h8-15,24H,5-7,16H2,1-4H3,(H,23,25) |
| InChIKey | SEUQHUSJABTFJF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|