C22H29N3O4S2 — CID 4936615
4-butoxy-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4936615) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4936615 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-butoxy-N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O4S2/c1-5-6-15-29-18-11-7-16(8-12-18)20(26)24-21(30)23-17-9-13-19(14-10-17)31(27,28)25-22(2,3)4/h7-14,25H,5-6,15H2,1-4H3,(H2,23,24,26,30) |
| InChIKey | WLSCCOSDBZAAQU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|