C21H27N3O4S2 — CID 4960309
N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-propoxybenzamide (PubChem CID 4960309) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-propoxybenzamide.
| Compound Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-propoxybenzamide |
|---|---|
| PubChem CID | 4960309 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[[4-(tert-butylsulfamoyl)phenyl]carbamothioyl]-3-propoxybenzamide |
| SMILES | CCCOc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-5-13-28-17-8-6-7-15(14-17)19(25)23-20(29)22-16-9-11-18(12-10-16)30(26,27)24-21(2,3)4/h6-12,14,24H,5,13H2,1-4H3,(H2,22,23,25,29) |
| InChIKey | NKGRWODLTUOSDB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|