C30H29N3O5S2 — CID 4955325
N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955325) has the molecular formula C30H29N3O5S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955325 |
| Molecular Formula | C30H29N3O5S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | N-[[4-[(2,6-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1cccc(C)c1NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H29N3O5S2/c1-21-8-6-9-22(2)28(21)33-40(35,36)27-16-14-24(15-17-27)31-30(39)32-29(34)23-10-7-13-26(20-23)38-19-18-37-25-11-4-3-5-12-25/h3-17,20,33H,18-19H2,1-2H3,(H2,31,32,34,39) |
| InChIKey | YOXIRUYKMZOJRC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|