C26H27N3O5S2 — CID 4955260
3-(2-phenoxyethoxy)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide (PubChem CID 4955260) has the molecular formula C26H27N3O5S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4955260 |
| Molecular Formula | C26H27N3O5S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-[(4-pyrrolidin-1-ylsulfonylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H27N3O5S2/c30-25(20-7-6-10-23(19-20)34-18-17-33-22-8-2-1-3-9-22)28-26(35)27-21-11-13-24(14-12-21)36(31,32)29-15-4-5-16-29/h1-3,6-14,19H,4-5,15-18H2,(H2,27,28,30,35) |
| InChIKey | UCVRFLFRGWONTN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|