C22H20N2O4S — CID 4955179
N-[(4-hydroxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955179) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[(4-hydroxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[(4-hydroxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955179 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[(4-hydroxyphenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(O)cc1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C22H20N2O4S/c25-18-11-9-17(10-12-18)23-22(29)24-21(26)16-5-4-8-20(15-16)28-14-13-27-19-6-2-1-3-7-19/h1-12,15,25H,13-14H2,(H2,23,24,26,29) |
| InChIKey | YBNXOWAAUMWOSS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|