C23H19N3O3S — CID 4955211
N-[(3-cyanophenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955211) has the molecular formula C23H19N3O3S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[(3-cyanophenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[(3-cyanophenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955211 |
| Molecular Formula | C23H19N3O3S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | N-[(3-cyanophenyl)carbamothioyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | N#Cc1cccc(NC(=S)NC(=O)c2cccc(OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H19N3O3S/c24-16-17-6-4-8-19(14-17)25-23(30)26-22(27)18-7-5-11-21(15-18)29-13-12-28-20-9-2-1-3-10-20/h1-11,14-15H,12-13H2,(H2,25,26,27,30) |
| InChIKey | MYJNQABJGAVUCZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|