C18H16BrN3O3S — CID 17356860
3-bromo-N-[(3-cyanophenyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17356860) has the molecular formula C18H16BrN3O3S and a molecular weight of 434.32 g/mol. Its IUPAC name is 3-bromo-N-[(3-cyanophenyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | 3-bromo-N-[(3-cyanophenyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17356860 |
| Molecular Formula | C18H16BrN3O3S |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 3-bromo-N-[(3-cyanophenyl)carbamothioyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)Nc2cccc(C#N)c2)cc1Br |
| InChI | InChI=1S/C18H16BrN3O3S/c1-24-7-8-25-16-6-5-13(10-15(16)19)17(23)22-18(26)21-14-4-2-3-12(9-14)11-20/h2-6,9-10H,7-8H2,1H3,(H2,21,22,23,26) |
| InChIKey | FUQSYAMLRZLVNI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|