C24H22BrN3O4S — CID 54781343
3-bromo-4-(2-methoxyethoxy)-N-[[3-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 54781343) has the molecular formula C24H22BrN3O4S and a molecular weight of 528.43 g/mol. Its IUPAC name is 3-bromo-4-(2-methoxyethoxy)-N-[[3-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(2-methoxyethoxy)-N-[[3-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54781343 |
| Molecular Formula | C24H22BrN3O4S |
| Molecular Weight | 528.43 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 3-bromo-4-(2-methoxyethoxy)-N-[[3-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | COCCOc1ccc(C(=O)NC(=S)Nc2cccc(C(=O)Nc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C24H22BrN3O4S/c1-31-12-13-32-21-11-10-17(15-20(21)25)23(30)28-24(33)27-19-9-5-6-16(14-19)22(29)26-18-7-3-2-4-8-18/h2-11,14-15H,12-13H2,1H3,(H,26,29)(H2,27,28,30,33) |
| InChIKey | KXDHTGMMHXBHSS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|