C23H21BrN2O4 — CID 17234914
N-(3-benzamidophenyl)-3-bromo-4-(2-methoxyethoxy)benzamide (PubChem CID 17234914) has the molecular formula C23H21BrN2O4 and a molecular weight of 469.34 g/mol. Its IUPAC name is N-(3-benzamidophenyl)-3-bromo-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-(3-benzamidophenyl)-3-bromo-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17234914 |
| Molecular Formula | C23H21BrN2O4 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | N-(3-benzamidophenyl)-3-bromo-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2cccc(NC(=O)c3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C23H21BrN2O4/c1-29-12-13-30-21-11-10-17(14-20(21)24)23(28)26-19-9-5-8-18(15-19)25-22(27)16-6-3-2-4-7-16/h2-11,14-15H,12-13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | FOVJKPJBSUCHKY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|