C25H25BrN2O3 — CID 17235626
3-bromo-4-butoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide (PubChem CID 17235626) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 17235626 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-bromo-4-butoxy-N-[3-[(2-phenylacetyl)amino]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2cccc(NC(=O)Cc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C25H25BrN2O3/c1-2-3-14-31-23-13-12-19(16-22(23)26)25(30)28-21-11-7-10-20(17-21)27-24(29)15-18-8-5-4-6-9-18/h4-13,16-17H,2-3,14-15H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | OGUUHXQSWVVGQV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|