C23H29BrN2O3 — CID 17189252
3-bromo-4-hexoxy-N-[3-(2-methylpropanoylamino)phenyl]benzamide (PubChem CID 17189252) has the molecular formula C23H29BrN2O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is 3-bromo-4-hexoxy-N-[3-(2-methylpropanoylamino)phenyl]benzamide.
| Compound Name | 3-bromo-4-hexoxy-N-[3-(2-methylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 17189252 |
| Molecular Formula | C23H29BrN2O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 3-bromo-4-hexoxy-N-[3-(2-methylpropanoylamino)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc(NC(=O)C(C)C)c2)cc1Br |
| InChI | InChI=1S/C23H29BrN2O3/c1-4-5-6-7-13-29-21-12-11-17(14-20(21)24)23(28)26-19-10-8-9-18(15-19)25-22(27)16(2)3/h8-12,14-16H,4-7,13H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | BXKDGDCULHGYGH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|