C24H31BrN2O3 — CID 17204617
3-bromo-N-[3-(2,2-dimethylpropanoylamino)phenyl]-4-hexoxybenzamide (PubChem CID 17204617) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 3-bromo-N-[3-(2,2-dimethylpropanoylamino)phenyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[3-(2,2-dimethylpropanoylamino)phenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 17204617 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-bromo-N-[3-(2,2-dimethylpropanoylamino)phenyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2cccc(NC(=O)C(C)(C)C)c2)cc1Br |
| InChI | InChI=1S/C24H31BrN2O3/c1-5-6-7-8-14-30-21-13-12-17(15-20(21)25)22(28)26-18-10-9-11-19(16-18)27-23(29)24(2,3)4/h9-13,15-16H,5-8,14H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | BPKUHJBUBULCAA-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|