C25H32BrN3O3S — CID 17204765
3-bromo-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-hexoxybenzamide (PubChem CID 17204765) has the molecular formula C25H32BrN3O3S and a molecular weight of 534.52 g/mol. Its IUPAC name is 3-bromo-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 17204765 |
| Molecular Formula | C25H32BrN3O3S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 3-bromo-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)C(C)(C)C)c2)cc1Br |
| InChI | InChI=1S/C25H32BrN3O3S/c1-5-6-7-8-14-32-21-13-12-17(15-20(21)26)22(30)29-24(33)28-19-11-9-10-18(16-19)27-23(31)25(2,3)4/h9-13,15-16H,5-8,14H2,1-4H3,(H,27,31)(H2,28,29,30,33) |
| InChIKey | DARYMNZTYOGKFD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|