C19H18BrN3O2S — CID 4956007
3-bromo-4-butoxy-N-[(3-cyanophenyl)carbamothioyl]benzamide (PubChem CID 4956007) has the molecular formula C19H18BrN3O2S and a molecular weight of 432.34 g/mol. Its IUPAC name is 3-bromo-4-butoxy-N-[(3-cyanophenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-butoxy-N-[(3-cyanophenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4956007 |
| Molecular Formula | C19H18BrN3O2S |
| Molecular Weight | 432.34 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-bromo-4-butoxy-N-[(3-cyanophenyl)carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2cccc(C#N)c2)cc1Br |
| InChI | InChI=1S/C19H18BrN3O2S/c1-2-3-9-25-17-8-7-14(11-16(17)20)18(24)23-19(26)22-15-6-4-5-13(10-15)12-21/h4-8,10-11H,2-3,9H2,1H3,(H2,22,23,24,26) |
| InChIKey | LASUWWXCGCDEBA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|