C28H31BrN2O3S — CID 17094955
3-bromo-N-[(3-hexoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17094955) has the molecular formula C28H31BrN2O3S and a molecular weight of 555.54 g/mol. Its IUPAC name is 3-bromo-N-[(3-hexoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[(3-hexoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17094955 |
| Molecular Formula | C28H31BrN2O3S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 3-bromo-N-[(3-hexoxyphenyl)carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | CCCCCCOc1cccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)c1 |
| InChI | InChI=1S/C28H31BrN2O3S/c1-2-3-4-8-17-33-24-13-9-12-23(20-24)30-28(35)31-27(32)22-14-15-26(25(29)19-22)34-18-16-21-10-6-5-7-11-21/h5-7,9-15,19-20H,2-4,8,16-18H2,1H3,(H2,30,31,32,35) |
| InChIKey | MMYUDCHOOAOEHX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|